CAS 845885-90-7 appears in our catalog under these names: 4-fluoro-3-formylbenzoic Acid, 4-Fluoro-3-formyl-benzoic acid, 97% , 4-Fluoro-3-formylbenzoic acid, 98%, 98%, 4-Fluoro-3-formylbenzoic acid, 97%. Offered by: Biosynth, Thermo Scientific, Chemat, Fluorochem, Ambeed. Available pack sizes: 50g, 25g, 250MG, 1g, 5g, 100g, 100mg, 10g.
4-fluoro-3-formylbenzoic acid (CAS 845885-90-7) is a chemical compound with the molecular formula C8H5FO3 and a molecular weight of 168.12 g/mol. IUPAC name: 4-fluoro-3-formylbenzoic acid. InChIKey: SKPWEADPCJMLID-UHFFFAOYSA-N.
| Molecular formula | C8H5FO3 |
|---|---|
| Molecular weight | 168.12 g/mol |
| IUPAC name | 4-fluoro-3-formylbenzoic acid |
| InChIKey | SKPWEADPCJMLID-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C=O)F |
Computed by PubChem (NCBI)