cas: 852940-49-9 — see every product listed under this CAS number, including other names
4-Fluoro-3-methylbenzo[b]thiophene-2-carboxylic acid, 98% (CAS 852940-49-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F626528-100MG |
| cas | 852940-49-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 122.89 Pln | |
| Fluorochem | 250mg | 200.99 Pln | |
| Fluorochem | 1g | 518.59 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
4-fluoro-3-methyl-1-benzothiophene-2-carboxylic acid (CAS 852940-49-9) is a chemical compound with the molecular formula C10H7FO2S and a molecular weight of 210.23 g/mol. IUPAC name: 4-fluoro-3-methyl-1-benzothiophene-2-carboxylic acid. InChIKey: SLKHVQZFOWEYQS-UHFFFAOYSA-N.
| Molecular formula | C10H7FO2S |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 4-fluoro-3-methyl-1-benzothiophene-2-carboxylic acid |
| InChIKey | SLKHVQZFOWEYQS-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=CC=CC(=C12)F)C(=O)O |
Computed by PubChem (NCBI)