CAS 1094254-19-9 appears in our catalog under these names: 5-Fluoro-3-methyl-1-benzothiophene-2-carboxylic acid, 95%, 5-Fluoro-3-methyl-1-benzothiophene-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
5-fluoro-3-methyl-1-benzothiophene-2-carboxylic acid (CAS 1094254-19-9) is a chemical compound with the molecular formula C10H7FO2S and a molecular weight of 210.23 g/mol. IUPAC name: 5-fluoro-3-methyl-1-benzothiophene-2-carboxylic acid. InChIKey: XJCCCHHWBCGPCB-UHFFFAOYSA-N.
| Molecular formula | C10H7FO2S |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 5-fluoro-3-methyl-1-benzothiophene-2-carboxylic acid |
| InChIKey | XJCCCHHWBCGPCB-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)