4-Fluoro-3-nitrophenylboronic acid 95%
cas: 352530-22-4 — see every product listed under this CAS number, including other names
4-Fluoro-3-nitrophenylboronic acid 95% (CAS 352530-22-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A108032-250mg |
| cas | 352530-22-4 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 253.56 Pln | |
| Ambeed | 5g | 848.75 Pln | |
| Ambeed | 10g | 1588.56 Pln | |
| Ambeed | 25g | 3107.12 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A108032 |
(4-fluoro-3-nitrophenyl)boronic acid (CAS 352530-22-4) is a chemical compound with the molecular formula C6H5BFNO4 and a molecular weight of 184.92 g/mol. IUPAC name: (4-fluoro-3-nitrophenyl)boronic acid. InChIKey: JDPKQZFQCPEJNH-UHFFFAOYSA-N.
| Molecular formula | C6H5BFNO4 |
|---|---|
| Molecular weight | 184.92 g/mol |
| IUPAC name | (4-fluoro-3-nitrophenyl)boronic acid |
| InChIKey | JDPKQZFQCPEJNH-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)[N+](=O)[O-])(O)O |
Computed by PubChem (NCBI)