Products 1256355-13-1

CAS 1256355-13-1 is the registry number for 6-Carboxy-2-fluoropyridine-3-boronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

5-borono-6-fluoropyridine-2-carboxylic acid (CAS 1256355-13-1) is a chemical compound with the molecular formula C6H5BFNO4 and a molecular weight of 184.92 g/mol. IUPAC name: 5-borono-6-fluoropyridine-2-carboxylic acid. InChIKey: OHOZXPHQLBZCJL-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5BFNO4
Molecular weight184.92 g/mol
IUPAC name5-borono-6-fluoropyridine-2-carboxylic acid
InChIKeyOHOZXPHQLBZCJL-UHFFFAOYSA-N
SMILESB(C1=C(N=C(C=C1)C(=O)O)F)(O)O

Computed by PubChem (NCBI)