Products 1451393-51-3
CAS 1451393-51-3 appears in our catalog under these names: 2-Fluoro-3-carboxypyridine-5-boronic acid, 2-Fluoro-3-carboxypyridine-5-boronic acid, 95%, 5-Borono-2-fluoronicotinic acid, 98%. Offered by: Fluorochem, Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg, 10g, 25g.
5-borono-2-fluoropyridine-3-carboxylic acid (CAS 1451393-51-3) is a chemical compound with the molecular formula C6H5BFNO4 and a molecular weight of 184.92 g/mol. IUPAC name: 5-borono-2-fluoropyridine-3-carboxylic acid. InChIKey: NINXDEFTKZXEEA-UHFFFAOYSA-N.
| Molecular formula | C6H5BFNO4 |
|---|---|
| Molecular weight | 184.92 g/mol |
| IUPAC name | 5-borono-2-fluoropyridine-3-carboxylic acid |
| InChIKey | NINXDEFTKZXEEA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1)F)C(=O)O)(O)O |
Computed by PubChem (NCBI)