CAS 1451393-25-1 appears in our catalog under these names: 5-(dihydroxyboranyl)-6-fluoropyridine-3-carboxylic acid, 98%, 5-Borono-6-fluoronicotinic acid, 98+%, 5-Carboxy-2-fluoropyridine-3-boronic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 250mg.
5-borono-6-fluoropyridine-3-carboxylic acid (CAS 1451393-25-1) is a chemical compound with the molecular formula C6H5BFNO4 and a molecular weight of 184.92 g/mol. IUPAC name: 5-borono-6-fluoropyridine-3-carboxylic acid. InChIKey: BCLGBTWNYVSWCI-UHFFFAOYSA-N.
| Molecular formula | C6H5BFNO4 |
|---|---|
| Molecular weight | 184.92 g/mol |
| IUPAC name | 5-borono-6-fluoropyridine-3-carboxylic acid |
| InChIKey | BCLGBTWNYVSWCI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CN=C1F)C(=O)O)(O)O |
Computed by PubChem (NCBI)