Products 860034-00-0
CAS 860034-00-0 appears in our catalog under these names: (4-fluoro-2-nitrophenyl)boronic acid, 95%, (4-Fluoro-2-nitrophenyl)boronic acid, 98%, (4-Fluoro-2-nitrophenyl)boronic acid 95%, 4-Fluoro-2-nitrophenylboronic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 250mg, 100mg.
(4-fluoro-2-nitrophenyl)boronic acid (CAS 860034-00-0) is a chemical compound with the molecular formula C6H5BFNO4 and a molecular weight of 184.92 g/mol. IUPAC name: (4-fluoro-2-nitrophenyl)boronic acid. InChIKey: LCMHLEDZCSXAFH-UHFFFAOYSA-N.
| Molecular formula | C6H5BFNO4 |
|---|---|
| Molecular weight | 184.92 g/mol |
| IUPAC name | (4-fluoro-2-nitrophenyl)boronic acid |
| InChIKey | LCMHLEDZCSXAFH-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)F)[N+](=O)[O-])(O)O |
Computed by PubChem (NCBI)