Products 1329171-65-4

CAS 1329171-65-4 appears in our catalog under these names: 5-Fluoro-2-nitrobenzeneboronic acid, 95%, (5–Fluoro–2–nitrophenyl)boronic acid, (5-Fluoro-2-nitrophenyl)boronic acid 95%, 5-FLUORO-2-NITROBENZENEBORONIC ACID, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg.

Structural formula: {0} (CAS {1})

(5-fluoro-2-nitrophenyl)boronic acid (CAS 1329171-65-4) is a chemical compound with the molecular formula C6H5BFNO4 and a molecular weight of 184.92 g/mol. IUPAC name: (5-fluoro-2-nitrophenyl)boronic acid. InChIKey: LCQRDFNZZCPGOO-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5BFNO4
Molecular weight184.92 g/mol
IUPAC name(5-fluoro-2-nitrophenyl)boronic acid
InChIKeyLCQRDFNZZCPGOO-UHFFFAOYSA-N
SMILESB(C1=C(C=CC(=C1)F)[N+](=O)[O-])(O)O

Computed by PubChem (NCBI)