4-Fluoro-7-nitro-1H-indazole, 97%
cas: 866144-02-7 — see every product listed under this CAS number, including other names
4-Fluoro-7-nitro-1H-indazole, 97% (CAS 866144-02-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F240472-100MG |
| cas | 866144-02-7 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 320.74 Pln | |
| Fluorochem | 250mg | 466.52 Pln | |
| Fluorochem | 500mg | 877.83 Pln | |
| Fluorochem | 1g | 945.52 Pln | |
| Fluorochem | 5g | 3121.84 Pln | |
| Fluorochem | 10g | 6188.46 Pln | |
| Fluorochem | 100mg | 320.74 Pln | |
| Fluorochem | 250mg | 466.52 Pln | |
| Fluorochem | 500mg | 877.83 Pln | |
| Fluorochem | 1g | 945.52 Pln | |
| Fluorochem | 5g | 3121.84 Pln | |
| Fluorochem | 10g | 6188.46 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-fluoro-7-nitro-1H-indazole (CAS 866144-02-7) is a chemical compound with the molecular formula C7H4FN3O2 and a molecular weight of 181.12 g/mol. IUPAC name: 4-fluoro-7-nitro-1H-indazole. InChIKey: CVMZDSQFDHLYSI-UHFFFAOYSA-N.
| Molecular formula | C7H4FN3O2 |
|---|---|
| Molecular weight | 181.12 g/mol |
| IUPAC name | 4-fluoro-7-nitro-1H-indazole |
| InChIKey | CVMZDSQFDHLYSI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=NNC2=C1[N+](=O)[O-])F |
Computed by PubChem (NCBI)