cas: 380336-99-2 — see every product listed under this CAS number, including other names
4-Formyl-2-methoxyphenyl cyclopropanecarboxylate, 98% (CAS 380336-99-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 500mg, 1g, 2.5g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A534427-10g |
| cas | 380336-99-2 |
| size | 10g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 4041.10 Pln | |
| AmBeed | 100mg | 525.70 Pln | |
| Fluorochem | 100mg | 362.39 Pln | |
| Fluorochem | 250mg | 482.14 Pln | |
| Fluorochem | 500mg | 726.85 Pln | |
| Fluorochem | 1g | 903.87 Pln | |
| Fluorochem | 2.5g | 1148.57 Pln | |
| Fluorochem | 5g | 1570.30 Pln | |
| Fluorochem | 10g | 2622.01 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(4-formyl-2-methoxyphenyl) cyclopropanecarboxylate (CAS 380336-99-2) is a chemical compound with the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. IUPAC name: (4-formyl-2-methoxyphenyl) cyclopropanecarboxylate. InChIKey: ZHAOJSWBZLZTFK-UHFFFAOYSA-N.
| Molecular formula | C12H12O4 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | (4-formyl-2-methoxyphenyl) cyclopropanecarboxylate |
| InChIKey | ZHAOJSWBZLZTFK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C=O)OC(=O)C2CC2 |
Computed by PubChem (NCBI)