Products 380336-99-2
CAS 380336-99-2 appears in our catalog under these names: 4-Formyl-2-methoxyphenyl cyclopropanecarboxylate, 95%, 4-Formyl-2-methoxyphenyl cyclopropanecarboxylate, 98%, 4-Formyl-2-methoxyphenyl cyclopropanecarboxylate, 98%, 98%, Cyclopropanecarboxylic acid 4–formyl–2–methoxy–phenyl ester. Offered by: Combi-blocks, AmBeed, Fluorochem, Chemat, GLPBio. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg, 500mg, 2.5g.
(4-formyl-2-methoxyphenyl) cyclopropanecarboxylate (CAS 380336-99-2) is a chemical compound with the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. IUPAC name: (4-formyl-2-methoxyphenyl) cyclopropanecarboxylate. InChIKey: ZHAOJSWBZLZTFK-UHFFFAOYSA-N.
| Molecular formula | C12H12O4 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | (4-formyl-2-methoxyphenyl) cyclopropanecarboxylate |
| InChIKey | ZHAOJSWBZLZTFK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C=O)OC(=O)C2CC2 |
Computed by PubChem (NCBI)