cas: 1218790-71-6 — see every product listed under this CAS number, including other names
4-Formyl-3,5-dimethylphenylboronic acid, 97%, 97% (CAS 1218790-71-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112700-100mg |
| cas | 1218790-71-6 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 251.60 Pln | |
| Chemat | 1g | 573.20 Pln | |
| Chemat | 5g | 1874.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(4-formyl-3,5-dimethylphenyl)boronic acid (CAS 1218790-71-6) is a chemical compound with the molecular formula C9H11BO3 and a molecular weight of 177.99 g/mol. IUPAC name: (4-formyl-3,5-dimethylphenyl)boronic acid. InChIKey: HMOKNSHYDFAZAZ-UHFFFAOYSA-N.
| Molecular formula | C9H11BO3 |
|---|---|
| Molecular weight | 177.99 g/mol |
| IUPAC name | (4-formyl-3,5-dimethylphenyl)boronic acid |
| InChIKey | HMOKNSHYDFAZAZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C)C=O)C)(O)O |
Computed by PubChem (NCBI)