cas: 58287-76-6 — see every product listed under this CAS number, including other names
4-Formyl-N,N-dimethylbenzamide, 95%, 95% (CAS 58287-76-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DTD9-100mg |
| cas | 58287-76-6 |
| size | 100mg |
| availability | 9.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 563.60 Pln | |
| Chemat | 250mg | 1010.00 Pln | |
| Chemat | 5g | 4610.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-formyl-N,N-dimethylbenzamide (CAS 58287-76-6) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 4-formyl-N,N-dimethylbenzamide. InChIKey: RXRYFFTVFMQTKA-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 4-formyl-N,N-dimethylbenzamide |
| InChIKey | RXRYFFTVFMQTKA-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC=C(C=C1)C=O |
Computed by PubChem (NCBI)