Products 58287-76-6
CAS 58287-76-6 appears in our catalog under these names: 4-Formyl-n,n-dimethylbenzamide, 96%, 4-Formyl-N,N-dimethyl-benzamide, 4-Formyl-N,N-dimethylbenzamide, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 0,5g, 100mg.
4-formyl-N,N-dimethylbenzamide (CAS 58287-76-6) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: 4-formyl-N,N-dimethylbenzamide. InChIKey: RXRYFFTVFMQTKA-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | 4-formyl-N,N-dimethylbenzamide |
| InChIKey | RXRYFFTVFMQTKA-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC=C(C=C1)C=O |
Computed by PubChem (NCBI)