4-Hydroxy-2-nitrobenzoic acid, 95%
cas: 74230-08-3 — see every product listed under this CAS number, including other names
4-Hydroxy-2-nitrobenzoic acid, 95% (CAS 74230-08-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat.
| brand | Combi-blocks |
|---|---|
| catalog number | WZ-9236-1g |
| cas | 74230-08-3 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 100mg | price on request | |
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 10g | price on request | |
| Fluorochem | 100mg | 195.78 Pln | |
| Fluorochem | 250mg | 294.71 Pln | |
| Fluorochem | 1g | 586.27 Pln | |
| Fluorochem | 5g | 2637.63 Pln | |
| Fluorochem | 10g | 5162.78 Pln | |
| Ambeed | 250mg | 537.25 Pln | |
| Ambeed | 1g | 1338.25 Pln | |
| Chemat | 100mg | 237.20 Pln | |
| Chemat | 250mg | 347.60 Pln | |
| Chemat | 1g | 1024.40 Pln | |
| Chemat | 5g | 3477.20 Pln | |
| BLDpharm | 100mg | 358.79 Pln | |
| BLDpharm | 250mg | 569.82 Pln | |
| BLDpharm | 1g | 1441.74 Pln | |
| BLDpharm | 5g | 4490.67 Pln | |
| BLDpharm | 10g | 8905.78 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
4-hydroxy-2-nitrobenzoic acid (CAS 74230-08-3) is a chemical compound with the molecular formula C7H5NO5 and a molecular weight of 183.12 g/mol. IUPAC name: 4-hydroxy-2-nitrobenzoic acid. InChIKey: FNDZIIJCKXGZJA-UHFFFAOYSA-N.
| Molecular formula | C7H5NO5 |
|---|---|
| Molecular weight | 183.12 g/mol |
| IUPAC name | 4-hydroxy-2-nitrobenzoic acid |
| InChIKey | FNDZIIJCKXGZJA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)