cas: 74230-08-3 — see every product listed under this CAS number, including other names
4-Hydroxy-2-nitrobenzoic acid, 97% (CAS 74230-08-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A236681-10g |
| cas | 74230-08-3 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 14151.13 Pln | |
| AmBeed | 5g | 7113.82 Pln | |
| AmBeed | 100mg | 467.11 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-hydroxy-2-nitrobenzoic acid (CAS 74230-08-3) is a chemical compound with the molecular formula C7H5NO5 and a molecular weight of 183.12 g/mol. IUPAC name: 4-hydroxy-2-nitrobenzoic acid. InChIKey: FNDZIIJCKXGZJA-UHFFFAOYSA-N.
| Molecular formula | C7H5NO5 |
|---|---|
| Molecular weight | 183.12 g/mol |
| IUPAC name | 4-hydroxy-2-nitrobenzoic acid |
| InChIKey | FNDZIIJCKXGZJA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)