cas: 140647-01-4 — see every product listed under this CAS number, including other names
4-Hydroxy-5-methoxy-2-nitrobenzoic acid, 99.50% (CAS 140647-01-4) is a chemical reagent available from Chemat. Available pack sizes: 250 mg, 5 g, 100 mg, 500 mg, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-22033-250 mg |
| cas | 140647-01-4 |
| size | 250 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 250 mg | 1629.30 Pln | |
| MedChemExpress | 5 g | 9189.73 Pln | |
| MedChemExpress | 100 mg | 876.97 Pln | |
| MedChemExpress | 500 mg | 2279.46 Pln | |
| MedChemExpress | 1 g | 3143.24 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.50% |
4-hydroxy-5-methoxy-2-nitrobenzoic acid (CAS 140647-01-4) is a chemical compound with the molecular formula C8H7NO6 and a molecular weight of 213.14 g/mol. IUPAC name: 4-hydroxy-5-methoxy-2-nitrobenzoic acid. InChIKey: RAPBNVDGGBJECM-UHFFFAOYSA-N.
| Molecular formula | C8H7NO6 |
|---|---|
| Molecular weight | 213.14 g/mol |
| IUPAC name | 4-hydroxy-5-methoxy-2-nitrobenzoic acid |
| InChIKey | RAPBNVDGGBJECM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)O)[N+](=O)[O-])O |
Computed by PubChem (NCBI)