CAS 271261-71-3 appears in our catalog under these names: Methyl 2,4-dihydroxy-5-nitrobenzoate 95%, Methyl 2,4-Dihydroxy-5-Nitrobenzoate, 95%, 95%, Methyl 2,4-dihydroxy-5-nitrobenzoate, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 500mg, 25g.
Methyl 2,4-dihydroxy-5-nitrobenzoate (CAS 271261-71-3) is a chemical compound with the molecular formula C8H7NO6 and a molecular weight of 213.14 g/mol. IUPAC name: methyl 2,4-dihydroxy-5-nitrobenzoate. InChIKey: RTNOQYZDKMGQGE-UHFFFAOYSA-N.
| Molecular formula | C8H7NO6 |
|---|---|
| Molecular weight | 213.14 g/mol |
| IUPAC name | methyl 2,4-dihydroxy-5-nitrobenzoate |
| InChIKey | RTNOQYZDKMGQGE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)