Products 98554-94-0
CAS 98554-94-0 is the registry number for Methyl 2,5-dihydroxy-3-nitrobenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2,5-dihydroxy-3-nitrobenzoate (CAS 98554-94-0) is a chemical compound with the molecular formula C8H7NO6 and a molecular weight of 213.14 g/mol. IUPAC name: methyl 2,5-dihydroxy-3-nitrobenzoate. InChIKey: DPBREQWLMPWHNK-UHFFFAOYSA-N.
| Molecular formula | C8H7NO6 |
|---|---|
| Molecular weight | 213.14 g/mol |
| IUPAC name | methyl 2,5-dihydroxy-3-nitrobenzoate |
| InChIKey | DPBREQWLMPWHNK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)O)[N+](=O)[O-])O |
Computed by PubChem (NCBI)
Synonyms:
methyl 2,5-dihydroxy-3-nitrobenzoate