Products 30578-88-2
CAS 30578-88-2 appears in our catalog under these names: methyl 2,6-dihydroxy-3-nitrobenzoate, Methyl 2,6-dihydroxy-3-nitrobenzoate, 95%, 95%. Offered by: Biosynth, Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g.
Methyl 2,6-dihydroxy-3-nitrobenzoate (CAS 30578-88-2) is a chemical compound with the molecular formula C8H7NO6 and a molecular weight of 213.14 g/mol. IUPAC name: methyl 2,6-dihydroxy-3-nitrobenzoate. InChIKey: VFGXSVIWUUDBSU-UHFFFAOYSA-N.
| Molecular formula | C8H7NO6 |
|---|---|
| Molecular weight | 213.14 g/mol |
| IUPAC name | methyl 2,6-dihydroxy-3-nitrobenzoate |
| InChIKey | VFGXSVIWUUDBSU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1O)[N+](=O)[O-])O |
Computed by PubChem (NCBI)