cas: 386207-63-2 — see every product listed under this CAS number, including other names
4-Hydroxyquinoline-8-carboxylic acid, 98+% (CAS 386207-63-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A562700-100mg |
| cas | 386207-63-2 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 629.86 Pln | |
| AmBeed | 5g | 7517.44 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-oxo-1H-quinoline-8-carboxylic acid (CAS 386207-63-2) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 4-oxo-1H-quinoline-8-carboxylic acid. InChIKey: HBZGTHSCSFZZGL-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 4-oxo-1H-quinoline-8-carboxylic acid |
| InChIKey | HBZGTHSCSFZZGL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)C(=O)O)NC=CC2=O |
Computed by PubChem (NCBI)