cas: 89-41-8 — see every product listed under this CAS number, including other names
4-Methoxy-3-nitrobenzoic Acid, >98.0%(GC)(T) (CAS 89-41-8) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | M1092-25G |
| cas | 89-41-8 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 133.10 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
4-methoxy-3-nitrobenzoic acid (CAS 89-41-8) is a chemical compound with the molecular formula C8H7NO5 and a molecular weight of 197.14 g/mol. IUPAC name: 4-methoxy-3-nitrobenzoic acid. InChIKey: ANXBDAFDZSXOPQ-UHFFFAOYSA-N.
| Molecular formula | C8H7NO5 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | 4-methoxy-3-nitrobenzoic acid |
| InChIKey | ANXBDAFDZSXOPQ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)