cas: 20440-94-2 — see every product listed under this CAS number, including other names
4-Methoxy-N-(4-methoxyphenyl)-N-phenylaniline, 95%, 95% (CAS 20440-94-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1130H8-250mg |
| cas | 20440-94-2 |
| size | 250mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 107.60 Pln | |
| Chemat | 10g | 150.80 Pln | |
| Chemat | 25g | 275.60 Pln | |
| Chemat | 50g | 491.60 Pln | |
| Chemat | 100g | 923.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-methoxy-N-(4-methoxyphenyl)-N-phenylaniline (CAS 20440-94-2) is a chemical compound with the molecular formula C20H19NO2 and a molecular weight of 305.4 g/mol. IUPAC name: 4-methoxy-N-(4-methoxyphenyl)-N-phenylaniline. InChIKey: ZJPTYHDCQPDNBH-UHFFFAOYSA-N.
| Molecular formula | C20H19NO2 |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | 4-methoxy-N-(4-methoxyphenyl)-N-phenylaniline |
| InChIKey | ZJPTYHDCQPDNBH-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)