CAS 932841-49-1 appears in our catalog under these names: 2-(4-Ethylphenyl)-3,6-dimethylquinoline-4-carboxylic acid, 95%, 2-(4-Ethylphenyl)-3,6-dimethylquinoline-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(4-ethylphenyl)-3,6-dimethylquinoline-4-carboxylic acid (CAS 932841-49-1) is a chemical compound with the molecular formula C20H19NO2 and a molecular weight of 305.4 g/mol. IUPAC name: 2-(4-ethylphenyl)-3,6-dimethylquinoline-4-carboxylic acid. InChIKey: CCLFONLNYXABDP-UHFFFAOYSA-N.
| Molecular formula | C20H19NO2 |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | 2-(4-ethylphenyl)-3,6-dimethylquinoline-4-carboxylic acid |
| InChIKey | CCLFONLNYXABDP-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C2=NC3=C(C=C(C=C3)C)C(=C2C)C(=O)O |
Computed by PubChem (NCBI)