cas: 794-94-5 — see every product listed under this CAS number, including other names
4-Methoxybenzoic Anhydride, 97%, 97% (CAS 794-94-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1162TD-1g |
| cas | 794-94-5 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 174.80 Pln | |
| Chemat | 5g | 362.00 Pln | |
| Chemat | 25g | 1384.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(4-methoxybenzoyl) 4-methoxybenzoate (CAS 794-94-5) is a chemical compound with the molecular formula C16H14O5 and a molecular weight of 286.28 g/mol. IUPAC name: (4-methoxybenzoyl) 4-methoxybenzoate. InChIKey: YGMHIBLUWGDWKP-UHFFFAOYSA-N.
| Molecular formula | C16H14O5 |
|---|---|
| Molecular weight | 286.28 g/mol |
| IUPAC name | (4-methoxybenzoyl) 4-methoxybenzoate |
| InChIKey | YGMHIBLUWGDWKP-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)OC(=O)C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)