cas: 171364-80-0 — see every product listed under this CAS number, including other names
4-Methoxycarbonylphenylboronic acid pinacol ester, 98%, 98% (CAS 171364-80-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114LNM-1g |
| cas | 171364-80-0 |
| size | 1g |
| availability | 585g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 112.40 Pln | |
| Chemat | 25g | 165.20 Pln | |
| Chemat | 50g | 266.00 Pln | |
| Chemat | 100g | 419.60 Pln | |
| Chemat | 500g | 1694.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (CAS 171364-80-0) is a chemical compound with the molecular formula C14H19BO4 and a molecular weight of 262.11 g/mol. IUPAC name: methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate. InChIKey: REIZEQZILPXYKS-UHFFFAOYSA-N.
| Molecular formula | C14H19BO4 |
|---|---|
| Molecular weight | 262.11 g/mol |
| IUPAC name | methyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| InChIKey | REIZEQZILPXYKS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)OC |
Computed by PubChem (NCBI)