cas: 76487-56-4 — see every product listed under this CAS number, including other names
4-Methoxyphenyl 4-(but-3-en-1-yloxy)benzoate 98% (CAS 76487-56-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A176651-250mg |
| cas | 76487-56-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 1377.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A176651 |
(4-methoxyphenyl) 4-but-3-enoxybenzoate (CAS 76487-56-4) is a chemical compound with the molecular formula C18H18O4 and a molecular weight of 298.3 g/mol. IUPAC name: (4-methoxyphenyl) 4-but-3-enoxybenzoate. InChIKey: CXPLNUIZUUBDCU-UHFFFAOYSA-N.
| Molecular formula | C18H18O4 |
|---|---|
| Molecular weight | 298.3 g/mol |
| IUPAC name | (4-methoxyphenyl) 4-but-3-enoxybenzoate |
| InChIKey | CXPLNUIZUUBDCU-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)OC(=O)C2=CC=C(C=C2)OCCC=C |
Computed by PubChem (NCBI)