cas: 50687-62-2 — see every product listed under this CAS number, including other names
4-Methoxyphenyl 4-Hydroxybenzoate, >99.0%(GC) (CAS 50687-62-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | H0825-5G |
| cas | 50687-62-2 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 585.48 Pln | |
| TCI | 25g | 1878.72 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >99.0%(GC) |
(4-methoxyphenyl) 4-hydroxybenzoate (CAS 50687-62-2) is a chemical compound with the molecular formula C14H12O4 and a molecular weight of 244.24 g/mol. IUPAC name: (4-methoxyphenyl) 4-hydroxybenzoate. InChIKey: MTQSVJUCLQYISS-UHFFFAOYSA-N.
| Molecular formula | C14H12O4 |
|---|---|
| Molecular weight | 244.24 g/mol |
| IUPAC name | (4-methoxyphenyl) 4-hydroxybenzoate |
| InChIKey | MTQSVJUCLQYISS-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)OC(=O)C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)