cas: 2377608-70-1 — see every product listed under this CAS number, including other names
4-Methyl-2-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 95%, 95% (CAS 2377608-70-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JNRJ-250mg |
| cas | 2377608-70-1 |
| size | 250mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1336.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 2377608-70-1) is a chemical compound with the molecular formula C14H19BO4 and a molecular weight of 262.11 g/mol. IUPAC name: 4-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: XSMZJBCPXNBVQY-UHFFFAOYSA-N.
| Molecular formula | C14H19BO4 |
|---|---|
| Molecular weight | 262.11 g/mol |
| IUPAC name | 4-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | XSMZJBCPXNBVQY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)C)C(=O)O |
Computed by PubChem (NCBI)