cas: 152628-03-0 — see every product listed under this CAS number, including other names
4-Methyl-2-propyl-1H-benzo[d]imidazole-6-carboxylic acid 98% (CAS 152628-03-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A198568-5g |
| cas | 152628-03-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 25g | 136.75 Pln | |
| Ambeed | 100g | 325.88 Pln | |
| Ambeed | 500g | 843.19 Pln | |
| Ambeed | 1000g | 1377.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A198568 |
7-methyl-2-propyl-3H-benzimidazole-5-carboxylic acid (CAS 152628-03-0) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 218.25 g/mol. IUPAC name: 7-methyl-2-propyl-3H-benzimidazole-5-carboxylic acid. InChIKey: XWAJTVCEILFDGU-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 7-methyl-2-propyl-3H-benzimidazole-5-carboxylic acid |
| InChIKey | XWAJTVCEILFDGU-UHFFFAOYSA-N |
| SMILES | CCCC1=NC2=C(N1)C=C(C=C2C)C(=O)O |
Computed by PubChem (NCBI)