cas: 152628-03-0 — see every product listed under this CAS number, including other names
4-Methyl-2-propyl-1H-benzo[d]imidazole-6-carboxylic acid, 98% (CAS 152628-03-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F092403-25G |
| cas | 152628-03-0 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 107.27 Pln | |
| Fluorochem | 100g | 206.20 Pln | |
| Fluorochem | 500g | 763.29 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
7-methyl-2-propyl-3H-benzimidazole-5-carboxylic acid (CAS 152628-03-0) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 218.25 g/mol. IUPAC name: 7-methyl-2-propyl-3H-benzimidazole-5-carboxylic acid. InChIKey: XWAJTVCEILFDGU-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 7-methyl-2-propyl-3H-benzimidazole-5-carboxylic acid |
| InChIKey | XWAJTVCEILFDGU-UHFFFAOYSA-N |
| SMILES | CCCC1=NC2=C(N1)C=C(C=C2C)C(=O)O |
Computed by PubChem (NCBI)