cas: 152628-03-0 — see every product listed under this CAS number, including other names
4-Methyl-2-propyl-1H-benzo[d]imidazole-6-carboxylic acid, 98%, 98% (CAS 152628-03-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114LQ0-10g |
| cas | 152628-03-0 |
| size | 10g |
| availability | 5000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 74.00 Pln | |
| Chemat | 25g | 83.60 Pln | |
| Chemat | 100g | 141.20 Pln | |
| Chemat | 500g | 523.20 Pln | |
| Chemat | 1kg | 918.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
7-methyl-2-propyl-3H-benzimidazole-5-carboxylic acid (CAS 152628-03-0) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 218.25 g/mol. IUPAC name: 7-methyl-2-propyl-3H-benzimidazole-5-carboxylic acid. InChIKey: XWAJTVCEILFDGU-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 7-methyl-2-propyl-3H-benzimidazole-5-carboxylic acid |
| InChIKey | XWAJTVCEILFDGU-UHFFFAOYSA-N |
| SMILES | CCCC1=NC2=C(N1)C=C(C=C2C)C(=O)O |
Computed by PubChem (NCBI)