cas: 10590-69-9 — see every product listed under this CAS number, including other names
4-Methylquinoline-2-carbonitrile, 98%, 98% (CAS 10590-69-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1195Y1-1g |
| cas | 10590-69-9 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 194.00 Pln | |
| Chemat | 5g | 707.60 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 93.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-methylquinoline-2-carbonitrile (CAS 10590-69-9) is a chemical compound with the molecular formula C11H8N2 and a molecular weight of 168.19 g/mol. IUPAC name: 4-methylquinoline-2-carbonitrile. InChIKey: MLZSCKRIEGYCKD-UHFFFAOYSA-N.
| Molecular formula | C11H8N2 |
|---|---|
| Molecular weight | 168.19 g/mol |
| IUPAC name | 4-methylquinoline-2-carbonitrile |
| InChIKey | MLZSCKRIEGYCKD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=CC=CC=C12)C#N |
Computed by PubChem (NCBI)