cas: 40507-59-3 — see every product listed under this CAS number, including other names
4-Nitro-1H-imidazole-5-carboxylic acid, 95%, 95% (CAS 40507-59-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114MX0-100mg |
| cas | 40507-59-3 |
| size | 100mg |
| availability | 2.95g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 280.40 Pln | |
| Chemat | 500mg | 438.80 Pln | |
| Chemat | 1g | 650.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-nitro-1H-imidazole-4-carboxylic acid (CAS 40507-59-3) is a chemical compound with the molecular formula C4H3N3O4 and a molecular weight of 157.08 g/mol. IUPAC name: 5-nitro-1H-imidazole-4-carboxylic acid. InChIKey: IQADWEQLYZUURU-UHFFFAOYSA-N.
| Molecular formula | C4H3N3O4 |
|---|---|
| Molecular weight | 157.08 g/mol |
| IUPAC name | 5-nitro-1H-imidazole-4-carboxylic acid |
| InChIKey | IQADWEQLYZUURU-UHFFFAOYSA-N |
| SMILES | C1=NC(=C(N1)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)