cas: 5334-40-7 — see every product listed under this CAS number, including other names
4-Nitro-1H-pyrazole-3-carboxylic acid, 98%, 98% (CAS 5334-40-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114LUE-1g |
| cas | 5334-40-7 |
| size | 1g |
| availability | 2000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 117.20 Pln | |
| Chemat | 25g | 179.60 Pln | |
| Chemat | 100g | 539.60 Pln | |
| Chemat | 500g | 2332.80 Pln | |
| Chemat | 1kg | 4475.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-nitro-1H-pyrazole-5-carboxylic acid (CAS 5334-40-7) is a chemical compound with the molecular formula C4H3N3O4 and a molecular weight of 157.08 g/mol. IUPAC name: 4-nitro-1H-pyrazole-5-carboxylic acid. InChIKey: ZMAXXOYJWZZQBK-UHFFFAOYSA-N.
| Molecular formula | C4H3N3O4 |
|---|---|
| Molecular weight | 157.08 g/mol |
| IUPAC name | 4-nitro-1H-pyrazole-5-carboxylic acid |
| InChIKey | ZMAXXOYJWZZQBK-UHFFFAOYSA-N |
| SMILES | C1=NNC(=C1[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)