cas: 2007917-56-6 — see every product listed under this CAS number, including other names
4-Nitro-3-(trifluoromethyl)-1H-pyrrolo(2,3-b)pyridine, 98% (CAS 2007917-56-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 100mg, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A778181-1g |
| cas | 2007917-56-6 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 2908.36 Pln | |
| AmBeed | 5g | 8565.55 Pln | |
| AmBeed | 100mg | 753.55 Pln | |
| AmBeed | 10g | 14229.25 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-nitro-3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine (CAS 2007917-56-6) is a chemical compound with the molecular formula C8H4F3N3O2 and a molecular weight of 231.13 g/mol. IUPAC name: 4-nitro-3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine. InChIKey: GQRUPHFLMGESHL-UHFFFAOYSA-N.
| Molecular formula | C8H4F3N3O2 |
|---|---|
| Molecular weight | 231.13 g/mol |
| IUPAC name | 4-nitro-3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | GQRUPHFLMGESHL-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=C1[N+](=O)[O-])C(=CN2)C(F)(F)F |
Computed by PubChem (NCBI)