Products 1186501-72-3
CAS 1186501-72-3 appears in our catalog under these names: 5-Nitro-3-(trifluoromethyl)-1h-pyrrolo[2,3-b]pyridine, 95%, 5-Nitro-3-(trifluoromethyl)-1H-pyrrolo(2,3-b)pyridine, 97%, 5-nitro-3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine, 97%, 97%, 5-NITRO-3-(TRIFLUOROMETHYL)-1H-PYRROLO[2,3-B]PYRIDINE, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 10g, 100mg, 500mg.
5-nitro-3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine (CAS 1186501-72-3) is a chemical compound with the molecular formula C8H4F3N3O2 and a molecular weight of 231.13 g/mol. IUPAC name: 5-nitro-3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine. InChIKey: BAFLUKHMOURLCD-UHFFFAOYSA-N.
| Molecular formula | C8H4F3N3O2 |
|---|---|
| Molecular weight | 231.13 g/mol |
| IUPAC name | 5-nitro-3-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | BAFLUKHMOURLCD-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1C(=CN2)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)