Products 1155800-54-6
CAS 1155800-54-6 is the registry number for 4-Amino-5-nitro-2-(trifluoromethyl)benzonitrile. Offered by: TRC. Available pack sizes: 2,5g.
4-amino-5-nitro-2-(trifluoromethyl)benzonitrile (CAS 1155800-54-6) is a chemical compound with the molecular formula C8H4F3N3O2 and a molecular weight of 231.13 g/mol. IUPAC name: 4-amino-5-nitro-2-(trifluoromethyl)benzonitrile. InChIKey: KUUHABIDZGASAV-UHFFFAOYSA-N.
| Molecular formula | C8H4F3N3O2 |
|---|---|
| Molecular weight | 231.13 g/mol |
| IUPAC name | 4-amino-5-nitro-2-(trifluoromethyl)benzonitrile |
| InChIKey | KUUHABIDZGASAV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])N)C(F)(F)F)C#N |
Computed by PubChem (NCBI)