Products 1186404-88-5
CAS 1186404-88-5 appears in our catalog under these names: 3-Nitro-6-(trifluoromethyl)imidazo[1,2-a]pyridine, 95%, 3-Nitro-6-(trifluoromethyl)imidazo(1,2-a)pyridine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
3-nitro-6-(trifluoromethyl)imidazo[1,2-a]pyridine (CAS 1186404-88-5) is a chemical compound with the molecular formula C8H4F3N3O2 and a molecular weight of 231.13 g/mol. IUPAC name: 3-nitro-6-(trifluoromethyl)imidazo[1,2-a]pyridine. InChIKey: IBQLEURBIDJSIC-UHFFFAOYSA-N.
| Molecular formula | C8H4F3N3O2 |
|---|---|
| Molecular weight | 231.13 g/mol |
| IUPAC name | 3-nitro-6-(trifluoromethyl)imidazo[1,2-a]pyridine |
| InChIKey | IBQLEURBIDJSIC-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(N2C=C1C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)