Products 1896831-02-9
CAS 1896831-02-9 is the registry number for 6-(Trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
6-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine-2-carboxylic acid (CAS 1896831-02-9) is a chemical compound with the molecular formula C8H4F3N3O2 and a molecular weight of 231.13 g/mol. IUPAC name: 6-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine-2-carboxylic acid. InChIKey: MJQIUZLIHKYVNX-UHFFFAOYSA-N.
| Molecular formula | C8H4F3N3O2 |
|---|---|
| Molecular weight | 231.13 g/mol |
| IUPAC name | 6-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridine-2-carboxylic acid |
| InChIKey | MJQIUZLIHKYVNX-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=NN2C=C1C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)