CAS 1048914-26-6 is the registry number for 3-Nitro-5-(trifluoromethyl)-1h-pyrrolo[2,3-b]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
3-nitro-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine (CAS 1048914-26-6) is a chemical compound with the molecular formula C8H4F3N3O2 and a molecular weight of 231.13 g/mol. IUPAC name: 3-nitro-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine. InChIKey: DVZJILBDNDRDCF-UHFFFAOYSA-N.
| Molecular formula | C8H4F3N3O2 |
|---|---|
| Molecular weight | 231.13 g/mol |
| IUPAC name | 3-nitro-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | DVZJILBDNDRDCF-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1C(=CN2)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)