cas: 23530-48-5 — see every product listed under this CAS number, including other names
4-Nitro-N-propan-2-ylbenzenesulfonamide (CAS 23530-48-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F609827-100MG |
| cas | 23530-48-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 310.33 Pln | |
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 1g | 1158.98 Pln | |
| Fluorochem | 5g | 3881.98 Pln |
| delivery time | 3-4 weeks |
|---|
4-nitro-N-propan-2-ylbenzenesulfonamide (CAS 23530-48-5) is a chemical compound with the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. IUPAC name: 4-nitro-N-propan-2-ylbenzenesulfonamide. InChIKey: IMRZQROLAZHXHR-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O4S |
|---|---|
| Molecular weight | 244.27 g/mol |
| IUPAC name | 4-nitro-N-propan-2-ylbenzenesulfonamide |
| InChIKey | IMRZQROLAZHXHR-UHFFFAOYSA-N |
| SMILES | CC(C)NS(=O)(=O)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)