cas: 15723-90-7 — see every product listed under this CAS number, including other names
4-Nitrobenzamidine, HCl 98% (CAS 15723-90-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A336073-1g |
| cas | 15723-90-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 220.19 Pln | |
| Ambeed | 25g | 359.25 Pln | |
| Ambeed | 100g | 1215.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A336073 |
4-nitrobenzenecarboximidamide;hydrochloride (CAS 15723-90-7) is a chemical compound with the molecular formula C7H8ClN3O2 and a molecular weight of 201.61 g/mol. IUPAC name: 4-nitrobenzenecarboximidamide;hydrochloride. InChIKey: CJXJAUKCHHAJQN-UHFFFAOYSA-N.
| Molecular formula | C7H8ClN3O2 |
|---|---|
| Molecular weight | 201.61 g/mol |
| IUPAC name | 4-nitrobenzenecarboximidamide;hydrochloride |
| InChIKey | CJXJAUKCHHAJQN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=N)N)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)