cas: 98-74-8 — see every product listed under this CAS number, including other names
4-Nitrobenzenesulfonyl chloride, 95% (CAS 98-74-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 415850050 |
| cas | 98-74-8 |
| size | 5g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5g | 147.00 Pln | |
| Thermo Scientific (Acros) | 25g | 259.25 Pln | |
| Thermo Scientific (Acros) | 100g | 699.35 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 95% |
4-nitrobenzenesulfonyl chloride (CAS 98-74-8) is a chemical compound with the molecular formula C6H4ClNO4S and a molecular weight of 221.62 g/mol. IUPAC name: 4-nitrobenzenesulfonyl chloride. InChIKey: JXRGUPLJCCDGKG-UHFFFAOYSA-N.
| Molecular formula | C6H4ClNO4S |
|---|---|
| Molecular weight | 221.62 g/mol |
| IUPAC name | 4-nitrobenzenesulfonyl chloride |
| InChIKey | JXRGUPLJCCDGKG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])S(=O)(=O)Cl |
Computed by PubChem (NCBI)