cas: 18598-74-8 — see every product listed under this CAS number, including other names
H-Ile-OMe·HCl 98% (CAS 18598-74-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A121861-10g |
| cas | 18598-74-8 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 131.19 Pln | |
| Ambeed | 25g | 147.88 Pln | |
| Ambeed | 100g | 331.44 Pln | |
| Ambeed | 500g | 526.12 Pln | |
| Ambeed | 1000g | 976.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A121861 |
Methyl (2S,3S)-2-amino-3-methylpentanoate;hydrochloride (CAS 18598-74-8) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. IUPAC name: methyl (2S,3S)-2-amino-3-methylpentanoate;hydrochloride. InChIKey: GGTBEWGOPAFTTH-GEMLJDPKSA-N.
| Molecular formula | C7H16ClNO2 |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | methyl (2S,3S)-2-amino-3-methylpentanoate;hydrochloride |
| InChIKey | GGTBEWGOPAFTTH-GEMLJDPKSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)OC)N.Cl |
Computed by PubChem (NCBI)