cas: 18598-74-8 — see every product listed under this CAS number, including other names
H-lle-OMe.HCl, 98% (CAS 18598-74-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | M03123-10G |
| cas | 18598-74-8 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 102.07 Pln | |
| Fluorochem | 25g | 107.27 Pln | |
| Fluorochem | 100g | 195.78 Pln | |
| Fluorochem | 500g | 508.17 Pln | |
| Fluorochem | 1kg | 955.93 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Methyl (2S,3S)-2-amino-3-methylpentanoate;hydrochloride (CAS 18598-74-8) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. IUPAC name: methyl (2S,3S)-2-amino-3-methylpentanoate;hydrochloride. InChIKey: GGTBEWGOPAFTTH-GEMLJDPKSA-N.
| Molecular formula | C7H16ClNO2 |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | methyl (2S,3S)-2-amino-3-methylpentanoate;hydrochloride |
| InChIKey | GGTBEWGOPAFTTH-GEMLJDPKSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)OC)N.Cl |
Computed by PubChem (NCBI)