cas: 99-81-0 — see every product listed under this CAS number, including other names
4-Nitrophenacyl bromide, 97% (CAS 99-81-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F018905-5G |
| cas | 99-81-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 81.24 Pln | |
| Fluorochem | 25g | 107.27 Pln | |
| Fluorochem | 100g | 206.20 Pln | |
| Fluorochem | 500g | 778.91 Pln | |
| Fluorochem | 1kg | 1497.41 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-bromo-1-(4-nitrophenyl)ethanone (CAS 99-81-0) is a chemical compound with the molecular formula C8H6BrNO3 and a molecular weight of 244.04 g/mol. IUPAC name: 2-bromo-1-(4-nitrophenyl)ethanone. InChIKey: MBUPVGIGAMCMBT-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO3 |
|---|---|
| Molecular weight | 244.04 g/mol |
| IUPAC name | 2-bromo-1-(4-nitrophenyl)ethanone |
| InChIKey | MBUPVGIGAMCMBT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CBr)[N+](=O)[O-] |
Computed by PubChem (NCBI)