cas: 959-22-8 — see every product listed under this CAS number, including other names
4-Nitrophenyl benzoate, 98%, 98% (CAS 959-22-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114LVV-1g |
| cas | 959-22-8 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 314.00 Pln | |
| Chemat | 10g | 534.80 Pln | |
| Chemat | 25g | 1101.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4-nitrophenyl) benzoate (CAS 959-22-8) is a chemical compound with the molecular formula C13H9NO4 and a molecular weight of 243.21 g/mol. IUPAC name: (4-nitrophenyl) benzoate. InChIKey: GMKZBFFLCONHDE-UHFFFAOYSA-N.
| Molecular formula | C13H9NO4 |
|---|---|
| Molecular weight | 243.21 g/mol |
| IUPAC name | (4-nitrophenyl) benzoate |
| InChIKey | GMKZBFFLCONHDE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)