cas: 4487-51-8 — see every product listed under this CAS number, including other names
4-Nitropyridin-2-ol, 98%, 98% (CAS 4487-51-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DGA3-100mg |
| cas | 4487-51-8 |
| size | 100mg |
| availability | 40g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 290.00 Pln | |
| Chemat | 1g | 621.20 Pln | |
| Chemat | 5g | 2248.40 Pln | |
| Chemat | 10g | 4158.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-nitro-1H-pyridin-2-one (CAS 4487-51-8) is a chemical compound with the molecular formula C5H4N2O3 and a molecular weight of 140.10 g/mol. IUPAC name: 4-nitro-1H-pyridin-2-one. InChIKey: STJAXIFXCBWILG-UHFFFAOYSA-N.
| Molecular formula | C5H4N2O3 |
|---|---|
| Molecular weight | 140.10 g/mol |
| IUPAC name | 4-nitro-1H-pyridin-2-one |
| InChIKey | STJAXIFXCBWILG-UHFFFAOYSA-N |
| SMILES | C1=CNC(=O)C=C1[N+](=O)[O-] |
Computed by PubChem (NCBI)